Currency: EUR

Resins for SPPS and SPOS

The search for novel pharmacological agents has focused on the preparation of chemical libraries as potential sources of new leads for drug discovery. Thus, combinatorial synthesis which allows the production of large arrays of molecular libraries has been the subject of an intense development. - Bachem offers a broad range of resins which are useful for many applications in combinatorial chemistry.Resins based on polystyrene-divinylbenzene 1%.
  • Name

  1. + Availability
    Wang resin, 4-HOCH₂-Ph-O-CH₂-Ph-polymer, 4-Benzyloxybenzyl alcohol resin
    D-2115.0005 5 g
    D-2115.0025 25 g
    D-2115.0100 100 g

  2. + Availability
    Wang resin, 4-Benzyloxybenzyl alcohol resin, 4-HOCH₂-Ph-O-CH₂-Ph-polymer
    D-1250.0005 5 g
    D-1250.0025 25 g
    D-1250.0100 100 g

  3. + Availability
    H₂NCH₂-Ph-polymer, AM resin, 1% DVB, AM resin
    D-1005.0005 5 g
    D-1005.0025 25 g
    D-1005.0100 100 g

  4. + Availability
    BHA resin · HCl, Ph-CH(NH₂)-Ph-polymer · HCl
    D-1010.0005 5 g
    D-1010.0025 25 g
    D-1010.0100 100 g

  5. + Availability
    D-2555.0001 1 g
    D-2555.0005 5 g

  6. + Availability
    2-ClTrt resin, 2-CTC resin
    D-2930.0005 5 g
    D-2930.0025 25 g

  7. + Availability
    2-ClTrt resin, 2-CTC resin
    D-1965.0005 5 g
    D-1965.0025 25 g

  8. + Availability
    Ellman's dihydropyran resin
    D-2530.0001 1 g
    D-2530.0005 5 g

  9. + Availability
    Rink amide resin, Rink amide PS resin, 1% DVB, 2',4'-Di-CH₃O-Ph-CH(NH-Fmoc)-Ph-4-OCH₂-polystyrene
    D-2080.0001 1 g
    D-2080.0005 5 g
    D-2080.0025 25 g

  10. + Availability
    Ph-CN₂-Ph-polymer, PDDM resin
    D-2230.0001 1 g
    D-2230.0005 5 g